For research use only. Not for therapeutic Use.
Illudin M(Cat No.:M048703)is a naturally occurring sesquiterpene toxin derived from the Jack O’Lantern mushroom (Omphalotus olearius). Known for its potent cytotoxic properties, it has been extensively studied in cancer research for its ability to inhibit tumor cell growth. Despite its toxicity, Illudin M serves as a precursor for developing more selective and less toxic anticancer agents, such as Irofulven. Its unique mechanism of action makes it a valuable compound in the exploration of novel therapeutic pathways, contributing significantly to oncology and pharmacology research.
CAS Number | 1146-04-9 |
Synonyms | DR-15977;(-)-Illudin M;NSC 400978;NSC 626370 |
Molecular Formula | C15H20O3 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (1S,5R)-1,5-dihydroxy-2,2,5,7-tetramethylspiro[1H-indene-6,1'-cyclopropane]-4-one |
InChI | InChI=1S/C15H20O3/c1-8-10-9(7-13(2,3)12(10)17)11(16)14(4,18)15(8)5-6-15/h7,12,17-18H,5-6H2,1-4H3/t12-,14+/m1/s1 |
InChIKey | QVMDIQLUNODCTG-OCCSQVGLSA-N |
SMILES | CC1=C2[C@H](C(C=C2C(=O)[C@](C13CC3)(C)O)(C)C)O |