For research use only. Not for therapeutic Use.
IM-12 (CAT: I000495) is a potent inhibitor of glycogen synthase kinase-3 beta (GSK-3β) with an IC50 of 53 nM. It exhibits significant activity in various biological assays, with comparable or even superior effects compared to the well-known GSK-3β inhibitor SB-216763. The inhibition of GSK-3β by IM-12 suggests its potential role in modulating GSK-3β-mediated signaling pathways, which are involved in various cellular processes such as cell proliferation, differentiation, and apoptosis.
CAS Number | 1129669-05-1 |
Synonyms | GSK3β Inhibitor XIX |
Molecular Formula | C₂₂H₂₀FN₃O₂ |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Solubility | DMSO: ≥ 54.9 mg/mL |
Storage | -20°C |
IC50 | 53 nM [1] |
InChI | InChI=1S/C22H20FN3O2/c1-13-18(16-5-3-4-6-17(16)25-13)19-20(22(28)26(2)21(19)27)24-12-11-14-7-9-15(23)10-8-14/h3-10,24-25H,11-12H2,1-2H3 |
InChIKey | ZKJAZFUFPPSFCO-UHFFFAOYSA-N |
SMILES | CC1=C(C2=CC=CC=C2N1)C3=C(C(=O)N(C3=O)C)NCCC4=CC=C(C=C4)F |
Reference | <p style=/line-height:25px/> |