For research use only. Not for therapeutic Use.
Imatinib free base（Cat No.:A000618）is a tyrosine kinase inhibitor that specifically targets the BCR-ABL fusion protein, which drives chronic myeloid leukemia (CML) and Philadelphia chromosome-positive acute lymphoblastic leukemia (Ph+ ALL). It also inhibits other tyrosine kinases, including c-Kit and PDGFR, making it effective in treating gastrointestinal stromal tumors (GIST) and certain myeloproliferative diseases. By blocking these kinases, imatinib disrupts abnormal signaling pathways, leading to reduced cancer cell proliferation and survival. This compound revolutionized cancer therapy, particularly for CML, and is a critical agent in research focused on targeted cancer treatments.
| Catalog Number | A000618 |
| CAS Number | 152459-95-5 |
| Synonyms | CGP057148B, ST-1571 |
| Molecular Formula | C₂₉H₃₁N₇O |
| Purity | ≥95% |
| Target | c-Kit |
| Solubility | >24.7mg/mL in DMSO |
| Storage | 3 years -20C powder |
| IUPAC Name | 4-[(4-methylpiperazin-1-yl)methyl]-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |
| InChI | InChI=1S/C29H31N7O/c1-21-5-10-25(18-27(21)34-29-31-13-11-26(33-29)24-4-3-12-30-19-24)32-28(37)23-8-6-22(7-9-23)20-36-16-14-35(2)15-17-36/h3-13,18-19H,14-17,20H2,1-2H3,(H,32,37)(H,31,33,34) |
| InChIKey | KTUFNOKKBVMGRW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)CN3CCN(CC3)C)NC4=NC=CC(=N4)C5=CN=CC=C5 |
