Imatinib free base（Cat No.:I007276）is a tyrosine kinase inhibitor that specifically targets the BCR-ABL fusion protein, a driver of chronic myeloid leukemia (CML). It also inhibits other tyrosine kinases, such as c-Kit and PDGFR, making it effective in treating gastrointestinal stromal tumors (GIST) and other cancers. By blocking these kinases, imatinib disrupts signaling pathways essential for cancer cell proliferation and survival. Its discovery revolutionized cancer therapy, particularly for CML, and it remains a critical compound in oncology research for studying targeted cancer treatments and kinase signaling pathways.
| Catalog Number | I007276 |
| CAS Number | 152459-95-5 (free base) |
| Synonyms | CGP 57148; CGP57148; CGP-57148; CGP57148B; CGP-57148B; CGP 57148B; STI571; STI-571; STI 571; Imatinib; US brand name: Gleevec. Foreign brand name: Glivec;N-(4-methyl-3-((4-(pyridin-3-yl)pyrimidin-2-yl)amino)phenyl)-4-((4-methylpiperazin-1-yl)methyl) |
| Molecular Formula | C29H31N7O |
| Purity | ≥95% |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term , or -20°C for long term. |
| IUPAC Name | 4-[(4-methylpiperazin-1-yl)methyl]-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |
| InChI | InChI=1S/C29H31N7O/c1-21-5-10-25(18-27(21)34-29-31-13-11-26(33-29)24-4-3-12-30-19-24)32-28(37)23-8-6-22(7-9-23)20-36-16-14-35(2)15-17-36/h3-13,18-19H,14-17,20H2,1-2H3,(H,32,37)(H,31,33,34) |
| InChIKey | KTUFNOKKBVMGRW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)CN3CCN(CC3)C)NC4=NC=CC(=N4)C5=CN=CC=C5 |
| Reference | </br> 1:Hughes A, Yong ASM. Immune Effector Recovery in Chronic Myeloid Leukemia and Treatment-Free Remission. Front Immunol. 2017 Apr 24;8:469. doi: 10.3389/fimmu.2017.00469. eCollection 2017. Review. PubMed PMID: 28484463; PubMed Central PMCID: PMC5402174. |
