For research use only. Not for therapeutic Use.
IMB-808（Cat No.:I029244）is an investigational small molecule being developed for the treatment of various cancers. It functions as a selective inhibitor of specific protein kinases involved in tumor cell proliferation, survival, and metastasis. By blocking these key signaling pathways, IMB-808 aims to disrupt the growth and spread of cancer cells, offering a targeted approach to cancer therapy. Preclinical studies have demonstrated its promising antitumor activity, particularly in solid tumors. Ongoing clinical trials are evaluating its safety, efficacy, and potential as a treatment for cancers resistant to conventional therapies.
| CAS Number | 870768-70-0 |
| Synonyms | N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| Molecular Formula | C18H15F3N2O4 |
| Purity | ≥95% |
| IUPAC Name | N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| InChI | InChI=1S/C18H15F3N2O4/c1-23(9-15(24)22-12-4-3-11(19)16(20)17(12)21)18(25)10-2-5-13-14(8-10)27-7-6-26-13/h2-5,8H,6-7,9H2,1H3,(H,22,24) |
| InChIKey | XITZPIXICJOKTF-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)NC1=C(C(=C(C=C1)F)F)F)C(=O)C2=CC3=C(C=C2)OCCO3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
