For research use only. Not for therapeutic Use.
Imeglimin（Cat No.:I004855）is an investigational oral medication being studied for the treatment of type 2 diabetes. It works by targeting multiple pathways involved in glucose metabolism, including improving insulin sensitivity, enhancing glucose-dependent insulin secretion, and reducing hepatic glucose production. Imeglimin has shown promise in clinical trials by helping to lower blood sugar levels without significant weight gain or hypoglycemia, which are common side effects of other diabetes medications. It is thought to have a unique mechanism of action, making it a potential therapeutic option for patients with type 2 diabetes. Further studies are ongoing to confirm its long-term safety and efficacy.
| Catalog Number | I004855 |
| CAS Number | 775351-65-0 |
| Synonyms | (4R)-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| Molecular Formula | C6H13N5 |
| Purity | ≥95% |
| Target | NF-κB |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20C |
| IUPAC Name | (4R)-6-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| InChI | InChI=1S/C6H13N5/c1-4-8-5(7)10-6(9-4)11(2)3/h4H,1-3H3,(H3,7,8,9,10)/t4-/m1/s1 |
| InChIKey | GFICWFZTBXUVIG-SCSAIBSYSA-N |
| SMILES | C[C@@H]1N=C(NC(=N1)N(C)C)N |
