For research use only. Not for therapeutic Use.
Imidacloprid(CAT: R012603) is a systemic insecticide that belongs to the neonicotinoid class of chemicals. It serves as an insect neurotoxin, primarily targeting the central nervous system of insects. Imidacloprid functions by disrupting the transmission of stimuli within the insect nervous system, leading to paralysis and ultimately the death of the targeted pests. Its systemic nature means that it can be absorbed by plants and spread throughout their tissues, making it effective in protecting crops from a wide range of insect pests.
| Catalog Number | R012603 |
| CAS Number | 138261-41-3 |
| Synonyms | (2E)-1-[(6-Chloro-3-pyridinyl)methyl]-N-nitro-2-imidazolidinimine; 1-[(6-Chloro-3-pyridinyl)methyl]-4,5-dihydro-N-nitro-1H-imidazol-2-amine; 1-[(6-Chloro-3-pyridinyl)methyl]-N-nitro-2-imidazolidinimine; Couraze; Premis; Grubex; |
| Molecular Formula | C9H10ClN5O2 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | (NE)-N-[1-[(6-chloropyridin-3-yl)methyl]imidazolidin-2-ylidene]nitramide |
| InChI | InChI=1S/C9H10ClN5O2/c10-8-2-1-7(5-12-8)6-14-4-3-11-9(14)13-15(16)17/h1-2,5H,3-4,6H2,(H,11,13) |
| InChIKey | YWTYJOPNNQFBPC-UHFFFAOYSA-N |
| SMILES | C1CN(C(=N[N+](=O)[O-])N1)CC2=CN=C(C=C2)Cl |
| Reference | <span style=”font-size:12px;”><span style=”font-family:arial,helvetica,sans-serif;”>1.<span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”>Elbert, A., et al. "Imidacloprid-a new systemic insecticide." </span><i style=”font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;”>Pflanzenschutz-Nachrichten Bayer (Germany, FR)</i><span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”> (1991).<br /> |
