For research use only. Not for therapeutic Use.
Imidaclothiz（Cat No.:R060444）is a systemic insecticide belonging to the neonicotinoid class, which acts by interfering with the nervous system of insects. It works by binding to nicotinic acetylcholine receptors in the insect’s central nervous system, causing overstimulation, paralysis, and eventually death. Imidaclothiz is primarily used to control a range of pests in agricultural crops, including insects that affect fruits, vegetables, and ornamental plants. Its selective toxicity allows for effective pest control while minimizing harm to beneficial insects and non-target species. Research continues to assess its environmental impact and long-term safety in agricultural use.
| CAS Number | 105843-36-5 |
| Synonyms | N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-yl]nitramide |
| Molecular Formula | C7H8ClN5O2S |
| Purity | ≥95% |
| IUPAC Name | N-[1-[(2-chloro-1,3-thiazol-5-yl)methyl]-4,5-dihydroimidazol-2-yl]nitramide |
| InChI | InChI=1S/C7H8ClN5O2S/c8-6-10-3-5(16-6)4-12-2-1-9-7(12)11-13(14)15/h3H,1-2,4H2,(H,9,11) |
| InChIKey | OWRSHPAYDYCHSJ-UHFFFAOYSA-N |
| SMILES | C1CN(C(=N1)N[N+](=O)[O-])CC2=CN=C(S2)Cl |
