For research use only. Not for therapeutic Use.
Imidazenil (CAT: M098238) is a chemical compound that belongs to the imidazobenzodiazepine class of drugs. It acts as a positive allosteric modulator of GABA-A receptors, which are neurotransmitter receptors in the brain that regulate inhibitory signaling. Imidazenil exhibits anxiolytic and sedative effects and has been studied for its potential use in treating anxiety disorders and other related conditions. Its mechanism of action involves enhancing the effects of the neurotransmitter GABA, leading to reduced neuronal excitability.
CAS Number | 151271-08-8 |
Synonyms | imidazenil |
Molecular Formula | C18H12BrFN4O |
Purity | ≥95% |
Storage | Desiccate at -20C |
Related CAS | 36057-54-2 1006-34-4 89346-54-3 933-90-4 |
IUPAC Name | 6-(2-bromophenyl)-8-fluoro-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide |
InChI | InChI=1S/C18H12BrFN4O/c19-13-4-2-1-3-11(13)16-12-7-10(20)5-6-14(12)24-9-23-17(18(21)25)15(24)8-22-16/h1-7,9H,8H2,(H2,21,25) |
InChIKey | OCJHYHKWUWSHEN-UHFFFAOYSA-N |
SMILES | C1C2=C(N=CN2C3=C(C=C(C=C3)F)C(=N1)C4=CC=CC=C4Br)C(=O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |