For research use only. Not for therapeutic Use.
Imidazo[1,2-a]pyridine-2-carboxamide is a fused heterocyclic compound featuring an imidazole ring and a pyridine moiety with a carboxamide group at the 2-position. This compound is significant in medicinal chemistry, known for its potential biological activities, including antitumor and anti-inflammatory properties. The carboxamide functionality enhances solubility and reactivity, allowing for further derivatization. Its unique structure makes it a valuable intermediate in the development of novel therapeutic agents and in exploring various applications in organic synthesis and drug discovery.
CAS Number | 39031-44-2 |
Molecular Formula | C8H7N3O |
Purity | ≥95% |
IUPAC Name | imidazo[1,2-a]pyridine-2-carboxamide |
InChI | InChI=1S/C8H7N3O/c9-8(12)6-5-11-4-2-1-3-7(11)10-6/h1-5H,(H2,9,12) |
InChIKey | BEHYAANJUKYBTH-UHFFFAOYSA-N |
SMILES | C1=CC2=NC(=CN2C=C1)C(=O)N |