For research use only. Not for therapeutic Use.
Imidazo[1,2-c]pyrimidin-5(6H)-one(Cat No.:L039040)is a fused heterocyclic compound featuring an imidazo-pyrimidine core with a keto group at the 5-position. This compound is of significant interest in pharmaceutical research due to its potential biological activity and role as a scaffold in drug development. It serves as a key intermediate in the synthesis of various bioactive molecules, including antiviral and anticancer agents. With its unique structure and high reactivity, Imidazo[1,2-c]pyrimidin-5(6H)-one is essential for advancing medicinal chemistry and the creation of novel therapeutic agents.
CAS Number | 55662-66-3 |
Molecular Formula | C6H5N3O |
Purity | ≥95% |
IUPAC Name | 6H-imidazo[1,2-c]pyrimidin-5-one |
InChI | InChI=1S/C6H5N3O/c10-6-8-2-1-5-7-3-4-9(5)6/h1-4H,(H,8,10) |
InChIKey | GICKXGZWALFYHZ-UHFFFAOYSA-N |
SMILES | C1=CNC(=O)N2C1=NC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |