For research use only. Not for therapeutic Use.
Imidazo[2,1-b]thiazole-2-carboxylic acid(CAT: L044282) is a high-purity heterocyclic compound widely employed in pharmaceutical and chemical research. Featuring an imidazo-thiazole core with a carboxylic acid functional group, it serves as a versatile building block for synthesizing bioactive molecules, including enzyme inhibitors, receptor modulators, and potential therapeutic agents. Its unique structure enables participation in various chemical transformations, such as amidation, esterification, and coupling reactions. With consistent quality and reactivity, Imidazo[2,1-b]thiazole-2-carboxylic acid is a valuable tool for advancing medicinal chemistry and developing innovative compounds for drug discovery and other applications.
CAS Number | 773841-78-4 |
Molecular Formula | C6H4N2O2S |
Purity | ≥95% |
IUPAC Name | imidazo[2,1-b][1,3]thiazole-2-carboxylic acid |
InChI | InChI=1S/C6H4N2O2S/c9-5(10)4-3-8-2-1-7-6(8)11-4/h1-3H,(H,9,10) |
InChIKey | FSTIEWRLYHVVHE-UHFFFAOYSA-N |
SMILES | C1=CN2C=C(SC2=N1)C(=O)O |