For research use only. Not for therapeutic Use.
Imidodisulfuryl fluoride lithium salt(Cat No.:M139135), is a chemical compound used as a reagent and catalyst in synthetic chemistry and organic synthesis. It contains both lithium and fluorine atoms, making it a valuable source of fluoride ions for various reactions. This compound is particularly useful in fluorination reactions, where it can facilitate the introduction of fluorine atoms into organic molecules. Imidodisulfuryl fluoride lithium salt’s unique properties and reactivity make it a versatile tool in the development of specialty chemicals and pharmaceuticals, aiding in the creation of new compounds and the modification of existing molecules for various research and industrial applications.
CAS Number | 171611-11-3 |
Molecular Formula | F2LiNO4S2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | lithium;bis(fluorosulfonyl)azanide |
InChI | InChI=1S/F2NO4S2.Li/c1-8(4,5)3-9(2,6)7;/q-1;+1 |
InChIKey | VDVLPSWVDYJFRW-UHFFFAOYSA-N |
SMILES | [Li+].[N-](S(=O)(=O)F)S(=O)(=O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |