For research use only. Not for therapeutic Use.
Iminostilbene N-Carbonyl Chloride (Cat No.:R011298) is also known as 5H-Dibenz[b,f]azepine-5-carbonyl Chloride; 5-(Chlorocarbonyl)-5H-dibenz[b,f]azepine, which can be used as pharmaceutical intermediates, mainly for the synthesis of drugs such as carbamazepine.
CAS Number | 33948-22-0 |
Synonyms | 5H-Dibenz[b,f]azepine-5-carbonyl Chloride; 5-(Chlorocarbonyl)-5H-dibenz[b,f]azepine; N-(Chlorocarbonyl)-5H-dibenz[b,f]azepine? |
Molecular Formula | C15H10ClNO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | benzo[b][1]benzazepine-11-carbonyl chloride |
InChI | InChI=1S/C15H10ClNO/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-10H |
InChIKey | APJYHXJGXDPGBA-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C=CC3=CC=CC=C3N2C(=O)Cl |