For research use only. Not for therapeutic Use.
Imiquimod Hydrochloride(CAT: I005738) is an immune response modifier that activates toll-like receptor 7 (TLR7), stimulating the innate immune system. This compound is primarily used in research related to dermatological and oncological conditions, including the treatment of skin cancers, actinic keratosis, and genital warts. By triggering the production of cytokines such as interferon-alpha, Imiquimod Hydrochloride enhances the body’s immune response against abnormal cells and viral infections. It is an essential tool for studies investigating immunotherapy, antiviral treatments, and tumor immunology. Its unique mechanism offers potential therapeutic insights into immune modulation and targeted therapies.
| Catalog Number | I005738 |
| CAS Number | 99011-78-6 |
| Synonyms | 1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine;hydrochloride |
| Molecular Formula | C14H17ClN4 |
| Purity | ≥95% |
| InChI | InChI=1S/C14H16N4.ClH/c1-9(2)7-18-8-16-12-13(18)10-5-3-4-6-11(10)17-14(12)15;/h3-6,8-9H,7H2,1-2H3,(H2,15,17);1H |
| InChIKey | RGKLRAHQVIHCCH-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N.Cl |
