For research use only. Not for therapeutic Use.
IMP2-IN-2（Cat No.:I043564）is a selective inhibitor targeting IMP2 (Insulin-like growth factor 2 mRNA-binding protein 2), a protein involved in regulating cell growth, differentiation, and survival. IMP2 plays a key role in controlling mRNA stability and translation, and its dysregulation has been implicated in various cancers and metabolic diseases. By inhibiting IMP2, IMP2-IN-2 aims to disrupt these processes, potentially reducing tumor progression and metastasis in cancer and modulating cellular responses in diseases associated with abnormal cell proliferation. Currently, it is being studied for its therapeutic potential in oncology and metabolic disorders.
| CAS Number | 1448353-39-6 |
| Synonyms | 3-[[benzyl(ethyl)carbamoyl]amino]-5-[4-(trifluoromethyl)phenyl]thiophene-2-carboxylic acid |
| Molecular Formula | C22H19F3N2O3S |
| Purity | ≥95% |
| IUPAC Name | 3-[[benzyl(ethyl)carbamoyl]amino]-5-[4-(trifluoromethyl)phenyl]thiophene-2-carboxylic acid |
| InChI | InChI=1S/C22H19F3N2O3S/c1-2-27(13-14-6-4-3-5-7-14)21(30)26-17-12-18(31-19(17)20(28)29)15-8-10-16(11-9-15)22(23,24)25/h3-12H,2,13H2,1H3,(H,26,30)(H,28,29) |
| InChIKey | SNHWNAMJHQFCTE-UHFFFAOYSA-N |
| SMILES | CCN(CC1=CC=CC=C1)C(=O)NC2=C(SC(=C2)C3=CC=C(C=C3)C(F)(F)F)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
