For research use only, not for therapeutic use.
Importazole is a cell-permeable inhibitor of importin-β, which transports cargo molecules bearing a nuclear localization signal into the nucleus. Importazole prevents nuclear import of GPF-tagged nuclear factor of activated T cells (NFAT-GFP) in HEK293 cells (IC<sub>50</sub> = 15 μM), which is reversible upon importazole washout. Importazole does not interfere with transportin-mediated nuclear import or chromosomal maintenance 1 (CRM1)-mediated nuclear export. Importazole inhibits nuclear import of topoisomerase IIβ binding protein 1 (TopBP1) in <em>Xenopus</em> egg extracts and of NF-κB in multiple myeloma cells. It also induces defects in spindle and microtubule formation <em>in vitro</em>.
| Catalog Number | R066972 |
| CAS Number | 662163-81-7 |
| Synonyms | IPZ |
| Molecular Formula | C20H22N4 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C20H22N4/c1-15(16-9-3-2-4-10-16)21-19-17-11-5-6-12-18(17)22-20(23-19)24-13-7-8-14-24/h2-6,9-12,15H,7-8,13-14H2,1H3,(H,21,22,23) |
| InChIKey | HKGJEZIGDHFJFL-UHFFFAOYSA-N |
| SMILES | [H]N(C(C1=CC=CC=C1)C)C2=NC(N3CCCC3)=NC4=C2C=CC=C4 |
| Reference | 1.Soderholm, J.F.,Bird, S.L.,Kalab, P., et al. Importazole, a small molecule inhibitor of the transport receptor importin-β. ACS Chem Biol. 6(7), 700-708 (2011). |
