For research use only. Not for therapeutic Use.
Apoptosis inducer blocking the cell cycle at G2 and inhibiting the production of PGE2/TNF-α; a long-acting anti-proliferative and anti-angiogenic agent; a small molecule developed as an anti-choroidal neovascularization (anti-CNV) drug
| Catalog Number | I029288 |
| CAS Number | 1031206-36-6 |
| Molecular Formula | C18H16O4 |
| Purity | ≥95% |
| IUPAC Name | (3E)-3-[(3-hydroxy-4-methoxyphenyl)methylidene]-6-methylchromen-4-one |
| InChI | InChI=1S/C18H16O4/c1-11-3-5-16-14(7-11)18(20)13(10-22-16)8-12-4-6-17(21-2)15(19)9-12/h3-9,19H,10H2,1-2H3/b13-8+ |
| SMILES | CC1=CC2=C(C=C1)OC/C(=C\C3=CC(=C(C=C3)OC)O)/C2=O |
| Reference | IA Falkenstein et al., Toxicity and intraocular properties of a novel long-acting anti-proliferative and anti-angiogenic compound IMS2186. Curr. Eye Res. 2008, 33, 599-609. |
