For research use only. Not for therapeutic Use.
Indanofan（Cat No.:M115715） is an innovative engineered protein designed as a therapeutic intervention for inflammatory diseases. It’s a fusion protein combining elements from human proteins involved in inflammation pathways, specifically targeting the interleukin-1 receptor-associated kinase 4 (IRAK4). By inhibiting IRAK4, Indanofan modulates the inflammatory response, offering potential benefits for conditions such as rheumatoid arthritis, psoriasis, and other autoimmune disorders. The design of Indanofan exemplifies advanced protein engineering techniques, using rational design and computational modeling to ensure specificity and efficacy while minimizing potential side effects.
| Catalog Number | M115715 |
| CAS Number | 133220-30-1 |
| Molecular Formula | C20H17ClO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-[[2-(3-chlorophenyl)oxiran-2-yl]methyl]-2-ethylindene-1,3-dione |
| InChI | InChI=1S/C20H17ClO3/c1-2-19(17(22)15-8-3-4-9-16(15)18(19)23)11-20(12-24-20)13-6-5-7-14(21)10-13/h3-10H,2,11-12H2,1H3 |
| InChIKey | PMAAYIYCDXGUAP-UHFFFAOYSA-N |
| SMILES | CCC1(C(=O)C2=CC=CC=C2C1=O)CC3(CO3)C4=CC(=CC=C4)Cl |
