For research use only. Not for therapeutic Use.
Indinavir (CAT: I001862), also known as MK-639 or L735524, is a potent and specific inhibitor of HIV protease. It belongs to the class of antiretroviral drugs known as protease inhibitors and is used in the treatment of HIV/AIDS. Indinavir works by inhibiting the activity of the HIV protease enzyme, which is essential for the replication of the virus. By blocking this enzyme, indinavir helps to prevent the cleavage of viral polyproteins, ultimately reducing the production of mature infectious viral particles. Indinavir is often used in combination with other antiretroviral drugs as part of highly active antiretroviral therapy (HAART) to effectively suppress HIV replication and improve the immune function of individuals living with HIV/AIDS.
| Catalog Number | I001862 |
| CAS Number | 150378-17-9 |
| Synonyms | Indinavir, Crixivan, L 735 524, MK-639 |
| Molecular Formula | C36H47N5O4 |
| Purity | ≥95% |
| Target | HIV Protease |
| Solubility | water：0.02 mg/mL |
| Storage | Desiccate at RT |
| InChI | InChI=1S/C36H47N5O4/c1-36(2,3)39-35(45)31-24-40(22-26-12-9-15-37-21-26)16-17-41(31)23-29(42)19-28(18-25-10-5-4-6-11-25)34(44)38-33-30-14-8-7-13-27(30)20-32(33)43/h4-15,21,28-29,31-33,42-43H,16-20,22-24H2,1-3H3,(H,38,44)(H,39,45)/t28-,29+,31+,32-,33+/m1/s1 |
| InChIKey | CBVCZFGXHXORBI-PXQQMZJSSA-N |
| SMILES | O=C([C@H]1N(C[C@@H](O)C[C@@H](CC2=CC=CC=C2)C(N[C@@H]3[C@H](O)CC4=C3C=CC=C4)=O)CCN(CC5=CC=CN=C5)C1)NC(C)(C)C |
| Reference | 1: Barrail-Tran A, Taburet AM, Poirier JM; Groupe Suivi Therapeutique <br> 3: Hoetelmans RM, Meenhorst PL, Mulder JW, Burger DM, Koks CH, Beijnen JH. 4: Chefchaouni MC, Thiounn N, Flam T, Zerbib M, Debré B. [Urinary calculi and <br> |
