For research use only. Not for therapeutic Use.
Indole-3-pyruvic Acid-d5(Cat No.:C000691)is a deuterated form of indole-3-pyruvic acid, where five hydrogen atoms are replaced with deuterium. This compound is a key intermediate in the biosynthesis of tryptophan and related metabolic pathways, making it valuable in biochemical and pharmaceutical research. The deuterium labeling allows for precise tracking in mass spectrometry, aiding in studies of metabolic processes, isotope tracing, and drug metabolism. Indole-3-pyruvic Acid-d5 is particularly useful in exploring the role of tryptophan derivatives in various physiological and pathological processes, including neurotransmitter synthesis and plant hormone regulation.
CAS Number | 85163-57-1 |
Synonyms | (Penta-Deuteroindolyl-3)-pyruvic Acid; |
Molecular Formula | C₁₁H₄D₅NO₃ |
Purity | ≥95% |
IUPAC Name | 2-oxo-3-(2,4,5,6,7-pentadeuterio-1H-indol-3-yl)propanoic acid |
InChI | InChI=1S/C11H9NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5H2,(H,14,15)/i1D,2D,3D,4D,6D |
InChIKey | RSTKLPZEZYGQPY-SNOLXCFTSA-N |
SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2)[2H])CC(=O)C(=O)O)[2H])[2H] |