For research use only. Not for therapeutic Use.
Indole-3-pyruvic acid (IPA) is an important intermediate in the biosynthesis of auxin, a class of plant hormones that regulate growth and development. It is derived from the amino acid tryptophan through enzymatic processes in plants. IPA plays a crucial role in signal transduction pathways, influencing various physiological processes such as cell elongation, root development, and fruit ripening. Additionally, IPA has garnered interest in pharmaceutical research due to its potential therapeutic properties, including antioxidant and anti-inflammatory effects, making it a subject of study for various health applications.
CAS Number | 392-12-1 |
Synonyms | 1H-Indole-3-propanoic acid |
Molecular Formula | C11H9NO3 |
Purity | ≥95% |
Target | Immunology/Inflammation |
Storage | RT |
IUPAC Name | 3-(1H-indol-3-yl)-2-oxopropanoic acid |
InChI | InChI=1S/C11H9NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,12H,5H2,(H,14,15) |
InChIKey | RSTKLPZEZYGQPY-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=CN2)CC(=O)C(=O)O |