For research use only. Not for therapeutic Use.
Indolokine A5, a catabolite of L-cysteine, is a potent AhR agonist[1].
| Catalog Number | I044973 |
| CAS Number | 951207-88-8 |
| Synonyms | 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxylic acid |
| Molecular Formula | C13H8N2O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C13H8N2O3S/c16-11(12-15-10(6-19-12)13(17)18)8-5-14-9-4-2-1-3-7(8)9/h1-6,14H,(H,17,18) |
| InChIKey | FWXYUFQKPJMQEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)C3=NC(=CS3)C(=O)O |
| Reference | [1]. Gatsios A, et, al. Escherichia coli small molecule metabolism at the host-microorganism interface. Nat Chem Biol. 2021 Oct;17(10):1016-1026. |
