For research use only. Not for therapeutic Use.
Indoramin（Cat No.:I029350）is a selective alpha-1 adrenergic receptor antagonist used primarily in the treatment of hypertension and other cardiovascular conditions. By blocking alpha-1 receptors, Indoramin relaxes smooth muscles in blood vessels, leading to vasodilation and a subsequent reduction in blood pressure. It also has mild sedative and anxiolytic effects due to its action on the central nervous system. Indoramin is valued in clinical settings for its ability to manage blood pressure effectively with minimal side effects. It is also explored in research for its potential applications in treating other vascular-related diseases.
| CAS Number | 26844-12-2 |
| Synonyms | N-[1-[2-(1H-indol-3-yl)ethyl]piperidin-4-yl]benzamide |
| Molecular Formula | C22H25N3O |
| Purity | ≥95% |
| IUPAC Name | N-[1-[2-(1H-indol-3-yl)ethyl]piperidin-4-yl]benzamide |
| InChI | InChI=1S/C22H25N3O/c26-22(17-6-2-1-3-7-17)24-19-11-14-25(15-12-19)13-10-18-16-23-21-9-5-4-8-20(18)21/h1-9,16,19,23H,10-15H2,(H,24,26) |
| InChIKey | JXZZEXZZKAWDSP-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1NC(=O)C2=CC=CC=C2)CCC3=CNC4=CC=CC=C43 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
