For research use only. Not for therapeutic Use.
Indotecan (CAT: I007332) is a potent indenoisoquinoline-based topoisomerase I inhibitor with significant potential in cancer research. By stabilizing the topoisomerase I-DNA complex, it disrupts DNA replication, leading to DNA damage and cancer cell death. Indotecan has demonstrated efficacy in treating various solid tumors, including lung and colon cancers, and is particularly valuable in overcoming resistance to traditional topoisomerase inhibitors. Its unique mechanism of action and promising preclinical outcomes make Indotecan a critical tool for advancing next-generation anticancer therapies and exploring novel approaches in tumor treatment.
| Catalog Number | I007332 |
| CAS Number | 915303-09-2 |
| Molecular Formula | C26H26N2O7 |
| Purity | ≥95% |
| Target | Topoisomerase |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4°C for short term , or -20°C for long term. |
| IUPAC Name | 15,16-dimethoxy-20-(3-morpholin-4-ylpropyl)-5,7-dioxa-20-azapentacyclo[10.8.0.02,10.04,8.013,18]icosa-1(12),2,4(8),9,13,15,17-heptaene-11,19-dione |
| InChI | InChI=1S/C26H26N2O7/c1-31-19-10-15-18(13-20(19)32-2)26(30)28(5-3-4-27-6-8-33-9-7-27)24-16-11-21-22(35-14-34-21)12-17(16)25(29)23(15)24/h10-13H,3-9,14H2,1-2H3 |
| InChIKey | FMFIFGLHVOZDEL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C3=C(C4=CC5=C(C=C4C3=O)OCO5)N(C2=O)CCCN6CCOCC6)OC |
