For research use only. Not for therapeutic Use.
Indotecan (LMP400) is a potent indenoisoquinoline-based topoisomerase I inhibitor used in cancer research. It disrupts the DNA replication process in cancer cells by stabilizing the topoisomerase I-DNA complex, leading to DNA damage and cell death. Indotecan has shown promise in treating a variety of solid tumors, including lung and colon cancers, making it a valuable tool for exploring new therapeutic approaches. Its unique mechanism of action and efficacy in overcoming resistance to traditional topoisomerase inhibitors highlight its potential in developing next-generation anticancer treatments.
| Catalog Number | I007332 |
| CAS Number | 915303-09-2 |
| Molecular Formula | C26H26N2O7 |
| Purity | ≥95% |
| Target | Topoisomerase |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4°C for short term , or -20°C for long term. |
| InChI | InChI=1S/C26H26N2O7/c1-31-19-10-15-18(13-20(19)32-2)26(30)28(5-3-4-27-6-8-33-9-7-27)24-16-11-21-22(35-14-34-21)12-17(16)25(29)23(15)24/h10-13H,3-9,14H2,1-2H3 |
| InChIKey | FMFIFGLHVOZDEL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C3=C(C4=CC5=C(C=C4C3=O)OCO5)N(C2=O)CCCN6CCOCC6)OC |
