For research use only. Not for therapeutic Use.
Inetetamab（Cat No.:I041203）is an investigational monoclonal antibody designed to target and inhibit the interleukin-6 (IL-6) receptor, a key mediator in inflammatory and autoimmune diseases. By blocking IL-6 signaling, Inetetamab aims to reduce inflammation and immune system dysfunction that contributes to conditions like rheumatoid arthritis, systemic lupus erythematosus, and certain types of cancer. Its potential therapeutic applications extend to a range of chronic inflammatory disorders, with ongoing research exploring its safety, efficacy, and long-term effects in clinical trials. Inetetamab represents a promising approach to modulating immune response in various disease contexts.
| CAS Number | 5334-30-5 |
| Molecular Formula | C11H9N5 |
| Purity | ≥95% |
| IUPAC Name | 1-phenylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChI | InChI=1S/C11H9N5/c12-10-9-6-15-16(11(9)14-7-13-10)8-4-2-1-3-5-8/h1-7H,(H2,12,13,14) |
| InChIKey | KKDPIZPUTYIBFX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=NC=NC(=C3C=N2)N |
