For research use only. Not for therapeutic Use.
INF4E（Cat No.:I033377）is an investigational compound under study for its potential therapeutic applications in oncology and immunotherapy. It is designed to target specific molecular pathways involved in tumor growth, immune modulation, and inflammation. By influencing these pathways, INF4E aims to inhibit cancer cell proliferation and enhance the body’s immune response against tumors. It is being explored for its efficacy in treating various cancers, including those resistant to conventional therapies. Ongoing clinical trials are assessing INF4E’s safety, efficacy, and potential to improve outcomes in cancer patients by modulating immune system activity.
| CAS Number | 88039-46-7 |
| Synonyms | ethyl 2-[(2-chlorophenyl)-hydroxymethyl]prop-2-enoate |
| Molecular Formula | C12H13ClO3 |
| Purity | ≥95% |
| IUPAC Name | ethyl 2-[(2-chlorophenyl)-hydroxymethyl]prop-2-enoate |
| InChI | InChI=1S/C12H13ClO3/c1-3-16-12(15)8(2)11(14)9-6-4-5-7-10(9)13/h4-7,11,14H,2-3H2,1H3 |
| InChIKey | BSRPDXCMAOIUOO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=C)C(C1=CC=CC=C1Cl)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
