For research use only. Not for therapeutic Use.
Influenza HA (307-319)(Cat No.:I018922)is a peptide derived from the hemagglutinin protein of the influenza virus, specifically the amino acid sequence spanning residues 307 to 319. This peptide plays a crucial role in the virus’s ability to bind to host cell receptors, facilitating viral entry. Researchers utilize Influenza HA (307-319) for studying viral pathogenesis, immune response, and developing antiviral agents or vaccines. It serves as a valuable tool in immunological assays and the design of therapeutic strategies aimed at disrupting influenza virus-host cell interactions and preventing viral infection.
CAS Number | 528526-85-4 |
Molecular Formula | C₆₉H₁₁₈N₁₈O₁₉ |
Purity | ≥95% |
Target | Influenza Virus |
IUPAC Name | 2-[4-[2-[4-[bis(2-hydroxyoctadeca-9,12-dienyl)amino]butyldisulfanyl]ethyl]piperazin-1-yl]ethyl 5-[bis(2-hydroxydecyl)amino]pentanoate |
InChI | InChI=1S/C73H140N4O6S2/c1-5-9-13-17-21-23-25-27-29-31-33-35-39-43-51-71(80)67-77(68-72(81)52-44-40-36-34-32-30-28-26-24-22-18-14-10-6-2)55-47-48-63-84-85-64-61-75-58-56-74(57-59-75)60-62-83-73(82)53-45-46-54-76(65-69(78)49-41-37-19-15-11-7-3)66-70(79)50-42-38-20-16-12-8-4/h21-24,27-30,69-72,78-81H,5-20,25-26,31-68H2,1-4H3 |
InChIKey | NWVNMPZABMFRQO-UHFFFAOYSA-N |
SMILES | CCCCCCCCC(CN(CCCCC(=O)OCCN1CCN(CC1)CCSSCCCCN(CC(CCCCCCC=CCC=CCCCCC)O)CC(CCCCCCC=CCC=CCCCCC)O)CC(CCCCCCCC)O)O |
Reference | [1]. Sriwilaijaroen N, et al. Molecular basis of the structure and function of H1 hemagglutinin of influenza virus. Proc Jpn Acad Ser B Phys Biol Sci. 2012;88(6):226-49. |