For research use only. Not for therapeutic Use.
INH14（Cat No.:I019326）, is a chemical compound with significance in the field of pharmacology and molecular biology. It serves as an inhibitor, targeting specific cellular pathways or proteins, and is typically employed in laboratory research to elucidate biological processes. The exact mechanisms and therapeutic applications of INH14 may vary depending on specific studies, but its selective inhibitory properties make it valuable for exploring and understanding various cellular and molecular processes. Consequently, INH14 contributes to advancing knowledge in these areas and holds potential for the development of targeted treatments for a range of diseases and conditions.
| Catalog Number | I019326 |
| CAS Number | 200134-22-1 |
| Molecular Formula | C₁₅H₁₆N₂O |
| Purity | ≥95% |
| Target | IKK |
| Storage | Room Temperature |
| IUPAC Name | 1-(4-ethylphenyl)-3-phenylurea |
| InChI | InChI=1S/C15H16N2O/c1-2-12-8-10-14(11-9-12)17-15(18)16-13-6-4-3-5-7-13/h3-11H,2H2,1H3,(H2,16,17,18) |
| InChIKey | CPCZNJSFVOOZOG-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)NC(=O)NC2=CC=CC=C2 |
| Reference | [1]. Drexel M, et al. INH14, a Small-Molecule Urea Derivative, Inhibits the IKKα/β-Dependent TLR Inflammatory Response. Chembiochem. 2019 Mar 1;20(5):710-717. |
