Iniparib（Cat No.:I002034）is an investigational anticancer agent initially developed as a poly (ADP-ribose) polymerase (PARP) inhibitor. It was primarily explored for treating triple-negative breast cancer (TNBC) and other solid tumors. By inhibiting PARP, Iniparib aimed to prevent DNA repair in cancer cells, thereby enhancing the cytotoxic effects of chemotherapy and promoting cancer cell death. Despite early promise, clinical trials revealed limited efficacy, leading to a reevaluation of its mechanism and potential. Iniparib’s development has provided valuable insights into cancer therapy and the complexities of PARP inhibition.
| Catalog Number | I002034 |
| CAS Number | 160003-66-7 |
| Synonyms | 4-iodo-3-nitrobenzamide |
| Molecular Formula | C₇H₅IN₂O₃ |
| Purity | ≥95% |
| Target | PARP |
| IUPAC Name | 4-iodo-3-nitrobenzamide |
| InChI | InChI=1S/C7H5IN2O3/c8-5-2-1-4(7(9)11)3-6(5)10(12)13/h1-3H,(H2,9,11) |
| InChIKey | MDOJTZQKHMAPBK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)[N+](=O)[O-])I |
