For research use only. Not for therapeutic Use.
Intoplicine（Cat No.:M115254）is an investigational antitumor agent with potent activity against various cancer types. It functions as a topoisomerase I and II inhibitor, disrupting DNA replication and transcription in cancer cells, leading to cell death. Intoplicine’s dual mechanism of action enhances its efficacy in combating resistant tumor cells. Its promising therapeutic profile includes potential applications in treating solid tumors and hematological malignancies. Ongoing research aims to optimize its clinical use, positioning Intoplicine as a valuable candidate in the development of novel cancer therapies.
| Catalog Number | M115254 |
| CAS Number | 125974-72-3 |
| Synonyms | 16-[3-(dimethylamino)propylamino]-13-methyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-5-ol |
| Molecular Formula | C21H24N4O |
| Purity | ≥95% |
| IUPAC Name | 16-[3-(dimethylamino)propylamino]-13-methyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13,15-octaen-5-ol |
| InChI | InChI=1S/C21H24N4O/c1-13-12-23-21(22-9-4-10-25(2)3)19-18-16-7-6-15(26)11-14(16)5-8-17(18)24-20(13)19/h5-8,11-12,24,26H,4,9-10H2,1-3H3,(H,22,23) |
| InChIKey | QROONAIPJKQFMC-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C2=C1NC3=C2C4=C(C=C3)C=C(C=C4)O)NCCCN(C)C |
