For research use only. Not for therapeutic Use.
INX-315 (Cat No.: I040154) is a novel small-molecule compound being investigated for its potential in cancer therapy. It is designed to target specific molecular pathways involved in tumor progression, particularly those that regulate cell growth, survival, and metastasis. INX-315 works by modulating key signaling networks, potentially enhancing the efficacy of existing cancer treatments and overcoming resistance mechanisms. Ongoing preclinical studies focus on understanding its mechanism of action, with hopes of positioning INX-315 as a valuable therapeutic option for solid tumors and hematologic cancers.
| CAS Number | 2745060-92-6 |
| Synonyms | 4-[(12-oxospiro[1,3,5,10,11-pentazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1′-cyclohexane]-4-yl)amino]benzenesulfonamide |
| Molecular Formula | C19H21N7O3S |
| Purity | ≥95% |
| InChI | InChI=1S/C19H21N7O3S/c20-30(28,29)14-6-4-13(5-7-14)22-18-21-11-12-10-15-24-25-17(27)19(8-2-1-3-9-19)26(15)16(12)23-18/h4-7,10-11,24H,1-3,8-9H2,(H,25,27)(H2,20,28,29)(H,21,22,23) |
| InChIKey | KGJVKYSVVOQPDL-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(=O)NNC3=CC4=CN=C(N=C4N23)NC5=CC=C(C=C5)S(=O)(=O)N |
| Reference | [1]. Dietrich C, et al. INX-315, a selective CDK2 inhibitor, induces cell cycle arrest and senescence in solid tumors. Cancer Discov. 2023 Dec 4. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
