For research use only. Not for therapeutic Use.
Iodoacetyl chloride is a chemical reagent used in organic synthesis and bioconjugation. It features both iodine and acyl chloride functional groups, making it reactive towards nucleophiles such as amines and thiols. This compound is particularly valuable in modifying proteins and peptides, enabling the introduction of iodoacetamide groups. Its reactivity facilitates the study of biomolecular interactions and the development of pharmaceuticals.
| Catalog Number | R031157 |
| CAS Number | 38020-81-4 |
| Synonyms | 2-Iodoacetyl Chloride |
| Molecular Formula | C2H2ClIO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-iodoacetyl chloride |
| InChI | InChI=1S/C2H2ClIO/c3-2(5)1-4/h1H2 |
| InChIKey | BSVMPWANOMFSPR-UHFFFAOYSA-N |
| SMILES | C(C(=O)Cl)I |
