For research use only. Not for therapeutic Use.
Iodoproxyfan（Cat No.:M090868） is a potent and selective histamine H3 receptor antagonist, meaning it blocks the action of histamine at the H3 receptor sites, which are primarily involved in the regulation of neurotransmitter release in the brain. It is particularly noted for its iodine substitution, which significantly enhances its affinity for these receptors. Iodoproxyfan has been extensively studied for its potential therapeutic effects in neurological and psychiatric disorders, including Alzheimer’s disease, attention deficit hyperactivity disorder (ADHD), and schizophrenia.
| Catalog Number | M090868 |
| CAS Number | 152028-96-1 |
| Synonyms | iodoproxyfan |
| Molecular Formula | C13H15IN2O |
| Purity | ≥95% |
| Storage | Desiccate at -20C |
| IUPAC Name | 5-[3-[(4-iodophenyl)methoxy]propyl]-1H-imidazole |
| InChI | InChI=1S/C13H15IN2O/c14-12-5-3-11(4-6-12)9-17-7-1-2-13-8-15-10-16-13/h3-6,8,10H,1-2,7,9H2,(H,15,16) |
| InChIKey | DCQNAFOCXVCDLB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1COCCCC2=CN=CN2)I |
