For research use only. Not for therapeutic Use.
Ionomycin free acid (Cat.No:I010507) is a calcium ionophore compound widely used in research to study cellular calcium signaling. It facilitates the transport of calcium ions across cell membranes, leading to an increase in intracellular calcium levels. Ionomycin free acid is particularly valuable in experiments that require precise control of intracellular calcium concentrations.
| Catalog Number | I010507 |
| CAS Number | 56092-81-0 |
| Synonyms | (4R,6S,8S,10Z,12R,14R,16E,18R,19R,20S,21S)-11,19,21-Trihydroxy-4,6,8,12,14,18,20-heptamethyl-22-[(2S,2/’R,5S,5/’S)-octahydro-5/’-[(1R)-1-hydroxyethyl]-2,5/’-dimethyl[2,2/’-bifuran]-5-yl]-9-oxo-10,16-docosadienoic acid |
| Molecular Formula | C41H72O9 |
| Purity | ≥95% |
| Target | Calcium Channel |
| Solubility | Soluble to 10 mM in ethanol and to 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (4R,6S,8S,10Z,12R,14R,16E,18R,19R,20S,21S)-11,19,21-trihydroxy-22-[(2S,5S)-5-[(2R,5S)-5-[(1R)-1-hydroxyethyl]-5-methyloxolan-2-yl]-5-methyloxolan-2-yl]-4,6,8,12,14,18,20-heptamethyl-9-oxodocosa-10,16-dienoic acid |
| InChI | InChI=1S/C41H72O9/c1-25(21-29(5)34(43)24-35(44)30(6)22-27(3)20-26(2)14-15-38(46)47)12-11-13-28(4)39(48)31(7)36(45)23-33-16-18-41(10,49-33)37-17-19-40(9,50-37)32(8)42/h11,13,24-33,36-37,39,42-43,45,48H,12,14-23H2,1-10H3,(H,46,47)/b13-11+,34-24-/t25-,26-,27+,28-,29-,30+,31+,32-,33+,36+,37-,39-,40+,41+/m1/s1 |
| InChIKey | PGHMRUGBZOYCAA-KCZOVTJBSA-N |
| SMILES | CC(CCC(=O)O)CC(C)CC(C)C(=O)C=C(C(C)CC(C)CC=CC(C)C(C(C)C(CC1CCC(O1)(C)C2CCC(O2)(C)C(C)O)O)O)O |
| Reference | Ionomycin, a new polyether antibiotic. Liu W-C. et al. J. Antibiot. 1978, 31, 815.<br /> |
