For research use only. Not for therapeutic Use.
Iothalamic Acid (CAT: I002737) is an ionic tri-iodinated benzoate compound that is commonly used as a contrast agent in diagnostic imaging procedures. It is primarily employed in radiographic examinations such as X-rays, computed tomography (CT), and angiography to enhance the visibility of certain tissues and organs. Iothalamic Acid, when administered intravenously or orally, selectively accumulates in specific areas of the body, allowing for improved visualization and delineation of anatomical structures during medical imaging. Its use helps healthcare professionals obtain clearer and more accurate diagnostic information. As a contrast agent, Iothalamic Acid undergoes rapid elimination from the body after imaging procedures.
| Catalog Number | I002737 |
| CAS Number | 2276-90-6 |
| Synonyms | 5-Acetamido-2,4,6-triiodo-N-methylisophthalamic acid; iothalamic acid |
| Molecular Formula | C11H9I3N2O4 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | 3-acetamido-2,4,6-triiodo-5-(methylcarbamoyl)benzoic acid |
| InChI | InChI=1S/C11H9I3N2O4/c1-3(17)16-9-7(13)4(10(18)15-2)6(12)5(8(9)14)11(19)20/h1-2H3,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | UXIGWFXRQKWHHA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C(=C(C(=C1I)C(=O)O)I)C(=O)NC)I |
| Reference | [1]. Ann Pharm Fr. 1972 Jun;30(6):473-6.<br /> |
