For research use only. Not for therapeutic Use.
IOX1 (Cat No.:I004180) is a potent inhibitor of 2OG oxygenases, specifically targeting the JmjC demethylases. It acts as a broad-spectrum inhibitor, meaning it can inhibit a wide range of enzymes belonging to the 2OG oxygenase family. JmjC demethylases are enzymes involved in the removal of methyl groups from histone proteins, playing a crucial role in epigenetic regulation. By inhibiting these enzymes, IOX1 can modulate gene expression and potentially impact various cellular processes. IOX1 has been widely used as a tool compound in research to study the functions and mechanisms of JmjC demethylases.
CAS Number | 5852-78-8 |
Synonyms | 8-hydroxyquinoline-5-carboxylic acid |
Molecular Formula | C₁₀H₇NO₃ |
Purity | ≥95% |
Target | Histone Demethylase |
Solubility | DMSO: ≥ 24 mg/mL |
Storage | Store at +4C |
IC50 | 0.6/0.1 uM(KDM4A/KDM3A) [1] |
IUPAC Name | 8-hydroxyquinoline-5-carboxylic acid |
InChI | InChI=1S/C10H7NO3/c12-8-4-3-7(10(13)14)6-2-1-5-11-9(6)8/h1-5,12H,(H,13,14) |
InChIKey | JGRPKOGHYBAVMW-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CC(=C2N=C1)O)C(=O)O |
Reference | <p style=/line-height:25px/> |