For research use only. Not for therapeutic Use.
IOX2(CAT: I005532) is a potent and selective inhibitor of hypoxia-inducible factor prolyl hydroxylase domain-containing protein (PHD), which plays a crucial role in oxygen sensing and regulation. By inhibiting PHD enzymes, IOX2 stabilizes HIF-1α, promoting the transcription of genes involved in angiogenesis, erythropoiesis, and cellular metabolism. This compound is widely used in research focused on cancer, ischemia, and metabolic diseases, where hypoxia and HIF signaling are key factors. IOX2 serves as an essential tool for investigating the mechanisms of hypoxia-related pathways, offering valuable insights into potential therapeutic strategies for treating hypoxia-associated conditions.
| Catalog Number | I005532 |
| CAS Number | 931398-72-0 |
| Synonyms | 2-[(1-benzyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]acetic acid |
| Molecular Formula | C19H16N2O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C19H16N2O5/c22-15(23)10-20-18(25)16-17(24)13-8-4-5-9-14(13)21(19(16)26)11-12-6-2-1-3-7-12/h1-9,24H,10-11H2,(H,20,25)(H,22,23) |
| InChIKey | CAOSCCRYLYQBES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=C(C2=O)C(=O)NCC(=O)O)O |
