IOX4 (CAST: I011403) is a potent and selective inhibitor of the hypoxia-inducible factor (HIF) prolyl hydroxylase enzyme. It inhibits the degradation of HIF transcription factors, leading to the stabilization and accumulation of HIF-α subunits and subsequent activation of HIF-dependent gene expression. IOX4 has been extensively studied for its potential therapeutic applications in diseases associated with hypoxia, such as cancer and ischemic conditions. By targeting the HIF pathway, IOX4 may modulate cellular responses to low oxygen levels and promote adaptive mechanisms. Further research is being conducted to explore its therapeutic potential and assess its efficacy in various disease models.
Catalog Number | I011403 |
CAS Number | 1154097-71-8 |
Synonyms | IOX4 |
Molecular Formula | C15H16N6O3 |
Purity | 95% |
Target | HIF |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | tert-butyl 6-[3-oxo-4-(triazol-1-yl)-1H-pyrazol-2-yl]pyridine-3-carboxylate |
InChI | InChI=1S/C15H16N6O3/c1-15(2,3)24-14(23)10-4-5-12(16-8-10)21-13(22)11(9-18-21)20-7-6-17-19-20/h4-9,18H,1-3H3 |
InChIKey | HWQQDVNGHZIALS-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)C1=CN=C(C=C1)N2C(=O)C(=CN2)N3C=CN=N3 |
Reference | 1: Chan MC, Atasoylu O, Hodson E, Tumber A, Leung IK, Chowdhury R, Gómez-Pérez V, |