For research use only. Not for therapeutic Use.
IPG7236(CAT: I040693) is a selective CCR8 antagonist developed for cancer immunotherapy research. By targeting CCR8, a chemokine receptor predominantly expressed on regulatory T cells (Tregs) within the tumor microenvironment, IPG7236 disrupts Treg-mediated immune suppression, thereby enhancing anti-tumor immune responses. In preclinical studies, IPG7236 demonstrated significant tumor suppression in a mouse xenograft model of human breast cancer, highlighting its potential to modulate the immune landscape and restore effective immune surveillance. Its specificity and efficacy make IPG7236 a valuable tool in cancer research, particularly for studying immune checkpoint resistance and developing novel immuno-oncology strategies.
| CAS Number | 2756350-91-9 |
| Synonyms | 2-methyl-N-[2-methyl-4-[[(1R)-1-(1-methylpiperidin-4-yl)ethyl]sulfamoyl]phenyl]benzamide |
| Molecular Formula | C23H31N3O3S |
| Purity | ≥95% |
| IUPAC Name | 2-methyl-N-[2-methyl-4-[[(1R)-1-(1-methylpiperidin-4-yl)ethyl]sulfamoyl]phenyl]benzamide |
| InChI | InChI=1S/C23H31N3O3S/c1-16-7-5-6-8-21(16)23(27)24-22-10-9-20(15-17(22)2)30(28,29)25-18(3)19-11-13-26(4)14-12-19/h5-10,15,18-19,25H,11-14H2,1-4H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | PDAOEKSLYKFTKF-GOSISDBHSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NC2=C(C=C(C=C2)S(=O)(=O)NC(C)C3CCN(CC3)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
