For research use only. Not for therapeutic Use.
Iproniazid is a pioneering monoamine oxidase inhibitor (MAOI), essential for advanced pharmaceutical and psychiatric research. This compound is crucial for studying the treatment of depression and other mood disorders. Its unique properties enable detailed analysis of neurotransmitter pathways and therapeutic effects. Iproniazid is highly valued for its historical significance and effectiveness, making it an indispensable tool in developing new antidepressants and enhancing our understanding of mental health treatments and neurochemical interactions.
| Catalog Number | R059018 |
| CAS Number | 54-92-2 |
| Synonyms | 4-Pyridinecarboxylic Acid 2-(1-Methylethyl)hydrazide; Isonicotinic Acid 2-Isopropylhydrazide; 1-Isonicotinoyl-2-isopropylhydrazine; Euphozid; IPN; Iprazid; Iprazide; Iproniazide; Isonicotinic Acid N’-Isopropyl Hydrazide; Marsalid; Marsilid; N’-Isopro |
| Molecular Formula | C9H13N3O |
| Purity | ≥95% |
| Target | Monoamine Oxidase |
| Storage | Store at +4C |
| IUPAC Name | N/'-propan-2-ylpyridine-4-carbohydrazide |
| InChI | InChI=1S/C9H13N3O/c1-7(2)11-12-9(13)8-3-5-10-6-4-8/h3-7,11H,1-2H3,(H,12,13) |
| InChIKey | NYMGNSNKLVNMIA-UHFFFAOYSA-N |
| SMILES | CC(C)NNC(=O)C1=CC=NC=C1 |
