For research use only. Not for therapeutic Use.
Ipronidazole-d3 (Cat No.:C000692) is a deuterium-labeled form of ipronidazole, an antiprotozoal and antibacterial medication used to treat infections caused by certain parasites and anaerobic bacteria. The deuterium substitution enhances molecular stability and allows for precise isotopic labeling for research purposes. Ipronidazole is known for its nitroimidazole structure, which can interfere with DNA synthesis in microorganisms.
| Catalog Number | C000692 |
| CAS Number | 1015855-83-0 |
| Synonyms | 1-(Methyl-d3)-2-(1-methylethyl)-5-nitro-1H-imidazole; 2-Isopropyl-1-(methyl-d3)- |
| Molecular Formula | C₇H₈D₃N₃O₂ |
| Purity | ≥95% |
| Solubility | Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly), Methanol (Very |
| Appearance | Off-White to Yellow Solid |
| Storage | 4°C |
| IUPAC Name | 5-nitro-2-propan-2-yl-1-(trideuteriomethyl)imidazole |
| InChI | InChI=1S/C7H11N3O2/c1-5(2)7-8-4-6(9(7)3)10(11)12/h4-5H,1-3H3/i3D3 |
| InChIKey | NTAFJUSDNOSFFY-HPRDVNIFSA-N |
| SMILES | CC(C)C1=NC=C(N1C)[N+](=O)[O-] |
| Reference | Butler, K., et al.: J. Med. Chem., 10, 891 (1967), Mitrovic, M., et al.:; Antimicrob. Agents Chemother., 445, 1968, Mitrovic, M., et al.: Poult. Sci., 49, 86 (1970), |
