For research use only. Not for therapeutic Use.
IQP-0528 is a potent non-nucleoside reverse transcriptase inhibitor (NNRTI) with significant antiviral activity, primarily used in HIV research. This compound inhibits HIV-1 reverse transcriptase, an enzyme essential for viral replication, thereby preventing the virus from converting its RNA into DNA within host cells. IQP-0528 is particularly notable for its application in microbicide formulations, aimed at preventing sexual transmission of HIV. Its effectiveness, combined with its favorable safety profile, makes IQP-0528 a promising candidate for developing topical HIV prevention therapies and exploring new strategies in antiviral drug research.
| Catalog Number | I007356 |
| CAS Number | 301297-45-0 |
| Synonyms | 1-(cyclopropylmethyl)-6-(3,5-dimethylbenzoyl)-5-propan-2-ylpyrimidine-2,4-dione |
| Molecular Formula | C20H24N2O3 |
| Purity | ≥95% |
| InChI | InChI=1S/C20H24N2O3/c1-11(2)16-17(18(23)15-8-12(3)7-13(4)9-15)22(10-14-5-6-14)20(25)21-19(16)24/h7-9,11,14H,5-6,10H2,1-4H3,(H,21,24,25) |
| InChIKey | UCOAKFIVSAVHLC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)C2=C(C(=O)NC(=O)N2CC3CC3)C(C)C)C |
