For research use only. Not for therapeutic Use.
IR415（Cat No.:I015555）is a synthetic compound known for its role in agricultural pest management and biochemical research. It functions as a potent insect growth regulator, targeting the development of insect pests by disrupting molting and reproduction processes. Its selective action minimizes harm to non-target species, making it a valuable tool in integrated pest management programs. Additionally, IR415 is used in laboratory studies to investigate insect physiology and growth mechanisms. Its efficiency and environmental compatibility position it as a critical component in sustainable pest control strategies and research applications.
| Catalog Number | I015555 |
| CAS Number | 452967-14-5 |
| Molecular Formula | C₁₃H₁₄F₂N₄S |
| Purity | ≥95% |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(3-imidazol-1-ylpropyl)thiourea |
| InChI | InChI=1S/C13H14F2N4S/c14-10-2-3-12(11(15)8-10)18-13(20)17-4-1-6-19-7-5-16-9-19/h2-3,5,7-9H,1,4,6H2,(H2,17,18,20) |
| InChIKey | KRSBPLFMLHNMPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)NC(=S)NCCCN2C=CN=C2 |
| Reference | [1]. Ghosh S, et al. An RNAi-based high-throughput screening assay to identify small molecule inhibitors of hepatitis B virus replication.J Biol Chem. 2017 Jul 28;292(30):12577-12588. |
