For research use only. Not for therapeutic Use.
Irdabisant is a selective histamine H3 receptor antagonist/inverse agonist, primarily used in neurological research. By blocking H3 receptors, irdabisant increases the release of neurotransmitters such as histamine, acetylcholine, and dopamine, enhancing cognitive function and wakefulness. This compound has been investigated for its potential to treat disorders such as narcolepsy, attention deficit hyperactivity disorder (ADHD), and cognitive impairments associated with neurodegenerative diseases. Its specificity and efficacy in modulating central nervous system activity make irdabisant a valuable tool in the development of therapies targeting cognitive and sleep disorders.
| Catalog Number | I007359 |
| CAS Number | 1005402-19-6 |
| Synonyms | 3-[4-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]phenyl]-1H-pyridazin-6-one |
| Molecular Formula | C18H23N3O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C18H23N3O2/c1-14-4-2-11-21(14)12-3-13-23-16-7-5-15(6-8-16)17-9-10-18(22)20-19-17/h5-10,14H,2-4,11-13H2,1H3,(H,20,22)/t14-/m1/s1 |
| InChIKey | XUKROCVZGZNGSI-CQSZACIVSA-N |
| SMILES | CC1CCCN1CCCOC2=CC=C(C=C2)C3=NNC(=O)C=C3 |
