For research use only. Not for therapeutic Use.
Iretol(Cat No.:I016811), also known as 2,4,6-trihydroxy anisole, is a degradation product of a glucoside derived from Iris Jorentina, a plant species. It serves as an intermediate compound in the synthesis of natural isoflavones, including Tectorigenin, Irigenin, and Caviunin. These isoflavones are bioactive compounds with various potential health benefits. Iretol’s formation occurs through the breakdown of the glucoside and plays a crucial role in the biosynthetic pathway of these isoflavones.
CAS Number | 487-71-8 |
Molecular Formula | C₇H₈O₄ |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Store at -20°C |
IUPAC Name | 2-methoxybenzene-1,3,5-triol |
InChI | InChI=1S/C7H8O4/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3,8-10H,1H3 |
InChIKey | ASTPOGDWGNJVEW-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1O)O)O |
Reference | [1]. Zhu-Ping Xiao, et al. 2,4,6-Trihydroxyanisole. Acta Cryst. (2007). E63, o2941. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |