For research use only. Not for therapeutic Use.
Irinotecan Hydrochloride（Cat No.:I000079）is a chemotherapeutic agent used primarily in the treatment of colorectal cancer and other solid tumors. As a topoisomerase I inhibitor, it interferes with DNA replication, ultimately inducing apoptosis in cancer cells. The hydrochloride form enhances its solubility and stability, facilitating effective administration. Irinotecan is often used in combination with other chemotherapy drugs to improve therapeutic outcomes. While it is effective, patients may experience side effects such as diarrhea and myelosuppression, necessitating careful monitoring.
| Catalog Number | I000079 |
| CAS Number | 100286-90-6 |
| Synonyms | CPT-11 Hcl |
| Molecular Formula | C₃₃H₃₈N₄O₆. HCl |
| Purity | ≥95% |
| Target | Topoisomerase I |
| Solubility | DMSO: ≥ 51 mg/mL |
| Storage | -20°C |
| IUPAC Name | [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 4-piperidin-1-ylpiperidine-1-carboxylate;hydrochloride |
| InChI | InChI=1S/C33H38N4O6.ClH/c1-3-22-23-16-21(43-32(40)36-14-10-20(11-15-36)35-12-6-5-7-13-35)8-9-27(23)34-29-24(22)18-37-28(29)17-26-25(30(37)38)19-42-31(39)33(26,41)4-2;/h8-9,16-17,20,41H,3-7,10-15,18-19H2,1-2H3;1H/t33-;/m0./s1 |
| InChIKey | GURKHSYORGJETM-WAQYZQTGSA-N |
| SMILES | CCC1=C2CN3C(=CC4=C(C3=O)COC(=O)[C@@]4(CC)O)C2=NC5=C1C=C(C=C5)OC(=O)N6CCC(CC6)N7CCCCC7.Cl |
| Reference | <p> |
