For research use only. Not for therapeutic Use.
Irinotecan（Cat No.:I005716）, also known as CPT-11, is a chemotherapeutic agent that acts by inhibiting the enzyme topoisomerase 1. By doing so, it prevents DNA from unwinding and inhibits the normal function of topoisomerase 1 in DNA replication and repair processes. This interference leads to DNA damage and ultimately cell death. Irinotecan is commonly used in the treatment of various cancers, including colorectal cancer, where it disrupts cancer cell growth and helps in managing the disease.
| Catalog Number | I005716 |
| CAS Number | 97682-44-5 |
| Synonyms | CPT11; CPT 11; (S)-4,11-diethyl-3,4,12,14-tetrahydro-4-hydroxy-3,14-dioxo-1H-pyrano[3′,4′:6,7]indolizino[1,2-b]quinolin-9-yl ester |
| Molecular Formula | C33H38N4O6 |
| Purity | ≥95% |
| Target | Topoisomerase |
| Solubility | DMSO: ≥ 32 mg/mL |
| Storage | 2-8°C |
| IC50 | 15.8 μM(LoVo cells); 5.17 μM(HT-29 cells) |
| IUPAC Name | [(19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl] 4-piperidin-1-ylpiperidine-1-carboxylate |
| InChI | InChI=1S/C33H38N4O6/c1-3-22-23-16-21(43-32(40)36-14-10-20(11-15-36)35-12-6-5-7-13-35)8-9-27(23)34-29-24(22)18-37-28(29)17-26-25(30(37)38)19-42-31(39)33(26,41)4-2/h8-9,16-17,20,41H,3-7,10-15,18-19H2,1-2H3/t33-/m0/s1 |
| InChIKey | UWKQSNNFCGGAFS-XIFFEERXSA-N |
| SMILES | CCC1=C2CN3C(=CC4=C(C3=O)COC(=O)[C@@]4(CC)O)C2=NC5=C1C=C(C=C5)OC(=O)N6CCC(CC6)N7CCCCC7 |
| Reference | <p> |
