For research use only. Not for therapeutic Use.
Irisolidone is a natural compound found in various plants, including Iris germanica. This compound contributes to the characteristic fragrance of iris flowers. It exhibits antioxidant properties and is of interest in cosmetic and fragrance industries for its scent and potential skincare benefits. Irisolidone’s natural occurrence and aromatic properties make it valuable in perfumery and cosmetic formulations.
Catalog Number | R072552 |
CAS Number | 2345-17-7 |
Molecular Formula | C17H14O6 |
Purity | ≥95% |
Target | Chloride Channel |
IUPAC Name | 5,7-dihydroxy-6-methoxy-3-(4-methoxyphenyl)chromen-4-one |
InChI | InChI=1S/C17H14O6/c1-21-10-5-3-9(4-6-10)11-8-23-13-7-12(18)17(22-2)16(20)14(13)15(11)19/h3-8,18,20H,1-2H3 |
InChIKey | VOOFPOMXNLNEOF-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C2=COC3=CC(=C(C(=C3C2=O)O)OC)O |