For research use only. Not for therapeutic Use.
Irloxacin（Cat No.:I029505）is a synthetic fluoroquinolone antibiotic known for its broad-spectrum activity against gram-negative and gram-positive bacteria. It works by inhibiting bacterial DNA gyrase and topoisomerase IV, enzymes critical for DNA replication and cell division, making it effective against respiratory, urinary, and gastrointestinal infections. In research, Irloxacin is studied for its pharmacokinetics, antimicrobial efficacy, and resistance mechanisms, contributing to the development of next-generation antibiotics. Its stability and high activity profile make it a valuable compound in studies aiming to combat bacterial resistance and improve infection control strategies.
| Catalog Number | I029505 |
| CAS Number | 91524-15-1 |
| Synonyms | E 3432; E3432; E-3432; Irloxacin; Pirfloxacin |
| Molecular Formula | C16H13FN2O3 |
| Purity | 98% |
| Target | Bacterial |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 1-ethyl-6-fluoro-4-oxo-7-pyrrol-1-ylquinoline-3-carboxylic acid |
| InChI | InChI=1S/C16H13FN2O3/c1-2-18-9-11(16(21)22)15(20)10-7-12(17)14(8-13(10)18)19-5-3-4-6-19/h3-9H,2H2,1H3,(H,21,22) |
| InChIKey | RZLHGQLYNZQZQQ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3C=CC=C3)F)C(=O)O |
| Reference | 1. Guzmán A, García C, Marín AP, Willoughby C, Demestre I. Developmental toxicity studies of the quinolone antibacterial agent irloxacin in rats and rabbits. Arzneimittelforschung. 2003;53(2):121-5. doi: 10.1055/s-0031-1297082. PMID: 12642968. |
